C14H24N2O3S2 — CID 63879120
2-methoxy-N-[[1-(5-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methyl]ethanamine (PubChem CID 63879120) has the molecular formula C14H24N2O3S2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 2-methoxy-N-[[1-(5-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[1-(5-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 63879120 |
| Molecular Formula | C14H24N2O3S2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-methoxy-N-[[1-(5-methylthiophen-2-yl)sulfonylpiperidin-3-yl]methyl]ethanamine |
| SMILES | COCCNCC1CCCN(S(=O)(=O)c2ccc(C)s2)C1 |
| InChI | InChI=1S/C14H24N2O3S2/c1-12-5-6-14(20-12)21(17,18)16-8-3-4-13(11-16)10-15-7-9-19-2/h5-6,13,15H,3-4,7-11H2,1-2H3 |
| InChIKey | MDZAIJWLUWQCOH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|