About [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate
[(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate (PubChem CID 11041132) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate.
Analyze [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate?
The IUPAC name of [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate (CID 11041132) is [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate.
What is the SMILES notation for [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate?
The canonical SMILES for [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate is CC(=O)O[C@@H]1C(=O)C=CO[C@H]1C.
What is the InChIKey of [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate?
The InChIKey is RKADDPYLNFMNRF-XNCJUZBTSA-N. The full InChI is InChI=1S/C8H10O4/c1-5-8(12-6(2)9)7(10)3-4-11-5/h3-5,8H,1-2H3/t5-,8-/m0/s1.
What are the key properties of [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate?
[(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate has a molecular weight of 170.16 g/mol, XLogP of 0.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-2-methyl-4-oxo-2,3-dihydropyran-3-yl] acetate is sourced from PubChem (CID 11041132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).