About 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one
3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one (PubChem CID 18721087) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one.
Analyze 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one?
The IUPAC name of 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one (CID 18721087) is 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one.
What is the SMILES notation for 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one?
The canonical SMILES for 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one is COCC1OC=CC(=O)C1OC.
What is the InChIKey of 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one?
The InChIKey is AIOOQCFKQVQKOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-10-5-7-8(11-2)6(9)3-4-12-7/h3-4,7-8H,5H2,1-2H3.
What are the key properties of 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one?
3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one has a molecular weight of 172.18 g/mol, XLogP of 0.13, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2-(methoxymethyl)-2,3-dihydropyran-4-one is sourced from PubChem (CID 18721087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).