C16H25ClN2O2S — CID 110413794
1-[3-(2-chlorophenyl)propyl]-4-propylsulfonylpiperazine (PubChem CID 110413794) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is 1-[3-(2-chlorophenyl)propyl]-4-propylsulfonylpiperazine.
| Compound Name | 1-[3-(2-chlorophenyl)propyl]-4-propylsulfonylpiperazine |
|---|---|
| PubChem CID | 110413794 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[3-(2-chlorophenyl)propyl]-4-propylsulfonylpiperazine |
| SMILES | CCCS(=O)(=O)N1CCN(CCCc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C16H25ClN2O2S/c1-2-14-22(20,21)19-12-10-18(11-13-19)9-5-7-15-6-3-4-8-16(15)17/h3-4,6,8H,2,5,7,9-14H2,1H3 |
| InChIKey | CCOVSWCAHUYGOZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |