C11H14ClN — CID 11041668
(1S,4S)-2-chloro-1,4-dimethylbicyclo[2.2.2]oct-5-ene-2-carbonitrile (PubChem CID 11041668) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is (1S,4S)-2-chloro-1,4-dimethylbicyclo[2.2.2]oct-5-ene-2-carbonitrile.
| Compound Name | (1S,4S)-2-chloro-1,4-dimethylbicyclo[2.2.2]oct-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 11041668 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | (1S,4S)-2-chloro-1,4-dimethylbicyclo[2.2.2]oct-5-ene-2-carbonitrile |
| SMILES | C[C@]12C=C[C@](C)(CC1)C(Cl)(C#N)C2 |
| InChI | InChI=1S/C11H14ClN/c1-9-3-5-10(2,6-4-9)11(12,7-9)8-13/h3,5H,4,6-7H2,1-2H3/t9-,10+,11?/m0/s1 |
| InChIKey | QZOWHVBOQYUBDD-MTULOOOASA-N |
| XLogP | 3.25 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|