C11H19NO — CID 7560631
(4R)-2,2-dimethyl-4-propan-2-yloxane-4-carbonitrile (PubChem CID 7560631) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-4-propan-2-yloxane-4-carbonitrile.
| Compound Name | (4R)-2,2-dimethyl-4-propan-2-yloxane-4-carbonitrile |
|---|---|
| PubChem CID | 7560631 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (4R)-2,2-dimethyl-4-propan-2-yloxane-4-carbonitrile |
| SMILES | CC(C)[C@@]1(C#N)CCOC(C)(C)C1 |
| InChI | InChI=1S/C11H19NO/c1-9(2)11(8-12)5-6-13-10(3,4)7-11/h9H,5-7H2,1-4H3/t11-/m0/s1 |
| InChIKey | RUQLWZBBBBYOAH-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |