C11H14ClNOS — CID 45115205
(1R)-2-chloro-1,4,5,6-tetramethyl-7-oxo-7λ4-thiabicyclo[2.2.1]hept-5-ene-2-carbonitrile (PubChem CID 45115205) has the molecular formula C11H14ClNOS and a molecular weight of 243.76 g/mol. Its IUPAC name is (1R)-2-chloro-1,4,5,6-tetramethyl-7-oxo-7λ4-thiabicyclo[2.2.1]hept-5-ene-2-carbonitrile.
| Compound Name | (1R)-2-chloro-1,4,5,6-tetramethyl-7-oxo-7λ4-thiabicyclo[2.2.1]hept-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 45115205 |
| Molecular Formula | C11H14ClNOS |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | (1R)-2-chloro-1,4,5,6-tetramethyl-7-oxo-7λ4-thiabicyclo[2.2.1]hept-5-ene-2-carbonitrile |
| SMILES | CC1=C(C)[C@@]2(C)S(=O)C1(C)CC2(Cl)C#N |
| InChI | InChI=1S/C11H14ClNOS/c1-7-8(2)10(4)11(12,6-13)5-9(7,3)15(10)14/h5H2,1-4H3/t9?,10-,11?,15?/m1/s1 |
| InChIKey | OPOOYPXXJNLWMU-SKTKSEMISA-N |
| XLogP | 2.51 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|