C14H14ClN3O — CID 110420482
N-(2-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 110420482) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 110420482 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-(2-chlorophenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C14H14ClN3O/c15-10-6-2-4-8-12(10)16-14(19)13-9-5-1-3-7-11(9)17-18-13/h2,4,6,8H,1,3,5,7H2,(H,16,19)(H,17,18) |
| InChIKey | YIWDIUNYBLUYHO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |