C18H25N3O4S — CID 110425662
N-[(1,2-dimethylindol-5-yl)methyl]-3-morpholin-4-ylsulfonylpropanamide (PubChem CID 110425662) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N-[(1,2-dimethylindol-5-yl)methyl]-3-morpholin-4-ylsulfonylpropanamide.
| Compound Name | N-[(1,2-dimethylindol-5-yl)methyl]-3-morpholin-4-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 110425662 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[(1,2-dimethylindol-5-yl)methyl]-3-morpholin-4-ylsulfonylpropanamide |
| SMILES | Cc1cc2cc(CNC(=O)CCS(=O)(=O)N3CCOCC3)ccc2n1C |
| InChI | InChI=1S/C18H25N3O4S/c1-14-11-16-12-15(3-4-17(16)20(14)2)13-19-18(22)5-10-26(23,24)21-6-8-25-9-7-21/h3-4,11-12H,5-10,13H2,1-2H3,(H,19,22) |
| InChIKey | OAZRNOLCYOAEEL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |