C14H24O3 — CID 11042854
(2E,6E)-6-methyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol (PubChem CID 11042854) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (2E,6E)-6-methyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol.
| Compound Name | (2E,6E)-6-methyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol |
|---|---|
| PubChem CID | 11042854 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (2E,6E)-6-methyl-8-(oxan-2-yloxy)octa-2,6-dien-1-ol |
| SMILES | C/C(=C\COC1CCCCO1)CC/C=C/CO |
| InChI | InChI=1S/C14H24O3/c1-13(7-3-2-5-10-15)9-12-17-14-8-4-6-11-16-14/h2,5,9,14-15H,3-4,6-8,10-12H2,1H3/b5-2+,13-9+ |
| InChIKey | DVPHZPFKAOOBSU-YAJGUJQZSA-N |
| XLogP | 2.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|