C19H19N5O2 — CID 110436285
N-(3-formamidopropyl)-4-(quinazolin-4-ylamino)benzamide (PubChem CID 110436285) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-(3-formamidopropyl)-4-(quinazolin-4-ylamino)benzamide.
| Compound Name | N-(3-formamidopropyl)-4-(quinazolin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 110436285 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-(3-formamidopropyl)-4-(quinazolin-4-ylamino)benzamide |
| SMILES | O=CNCCCNC(=O)c1ccc(Nc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C19H19N5O2/c25-13-20-10-3-11-21-19(26)14-6-8-15(9-7-14)24-18-16-4-1-2-5-17(16)22-12-23-18/h1-2,4-9,12-13H,3,10-11H2,(H,20,25)(H,21,26)(H,22,23,24) |
| InChIKey | BWZFFAXBBBJQOH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|