C15H20O4 — CID 11043645
2-(2-ethenylcyclohexen-1-yl)-3,4,4-trimethoxycyclobut-2-en-1-one (PubChem CID 11043645) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(2-ethenylcyclohexen-1-yl)-3,4,4-trimethoxycyclobut-2-en-1-one.
| Compound Name | 2-(2-ethenylcyclohexen-1-yl)-3,4,4-trimethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 11043645 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-(2-ethenylcyclohexen-1-yl)-3,4,4-trimethoxycyclobut-2-en-1-one |
| SMILES | C=CC1=C(C2=C(OC)C(OC)(OC)C2=O)CCCC1 |
| InChI | InChI=1S/C15H20O4/c1-5-10-8-6-7-9-11(10)12-13(16)15(18-3,19-4)14(12)17-2/h5H,1,6-9H2,2-4H3 |
| InChIKey | WDKBUFUIBIKOLY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|