C20H21ClN2O — CID 110440837
(E)-N-[1-(4-chlorophenyl)cyclopropyl]-3-[4-(dimethylamino)phenyl]prop-2-enamide (PubChem CID 110440837) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is (E)-N-[1-(4-chlorophenyl)cyclopropyl]-3-[4-(dimethylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[1-(4-chlorophenyl)cyclopropyl]-3-[4-(dimethylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 110440837 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (E)-N-[1-(4-chlorophenyl)cyclopropyl]-3-[4-(dimethylamino)phenyl]prop-2-enamide |
| SMILES | CN(C)c1ccc(/C=C/C(=O)NC2(c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21ClN2O/c1-23(2)18-10-3-15(4-11-18)5-12-19(24)22-20(13-14-20)16-6-8-17(21)9-7-16/h3-12H,13-14H2,1-2H3,(H,22,24)/b12-5+ |
| InChIKey | SZIGOXDMGQSYFZ-LFYBBSHMSA-N |
| XLogP | 4.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|