C18H21NSi — CID 11044145
N,2,4-trimethyl-2-silatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-amine (PubChem CID 11044145) has the molecular formula C18H21NSi and a molecular weight of 279.46 g/mol. Its IUPAC name is N,2,4-trimethyl-2-silatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-amine.
| Compound Name | N,2,4-trimethyl-2-silatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-amine |
|---|---|
| PubChem CID | 11044145 |
| Molecular Formula | C18H21NSi |
| Molecular Weight | 279.46 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N,2,4-trimethyl-2-silatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-amine |
| SMILES | CN[Si]1(C)CC(C)c2cccc3c2C1c1ccccc1-3 |
| InChI | InChI=1S/C18H21NSi/c1-12-11-20(3,19-2)18-16-8-5-4-7-14(16)15-10-6-9-13(12)17(15)18/h4-10,12,18-19H,11H2,1-3H3 |
| InChIKey | YQCJJZUIUZTYTC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|