C17H18N4O3 — CID 110443001
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 110443001) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 110443001 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1n[nH]c(C)c1CNC(=O)C(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H18N4O3/c1-9-14(10(2)20-19-9)8-18-15(22)11(3)21-16(23)12-6-4-5-7-13(12)17(21)24/h4-7,11H,8H2,1-3H3,(H,18,22)(H,19,20) |
| InChIKey | FMIGMZKCTLDGEU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|