C14H12BrFO — CID 11044629
(1S,2R)-2-bromo-2-(2-fluorophenyl)-1-phenylethanol (PubChem CID 11044629) has the molecular formula C14H12BrFO and a molecular weight of 295.15 g/mol. Its IUPAC name is (1S,2R)-2-bromo-2-(2-fluorophenyl)-1-phenylethanol.
| Compound Name | (1S,2R)-2-bromo-2-(2-fluorophenyl)-1-phenylethanol |
|---|---|
| PubChem CID | 11044629 |
| Molecular Formula | C14H12BrFO |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | (1S,2R)-2-bromo-2-(2-fluorophenyl)-1-phenylethanol |
| SMILES | O[C@@H](c1ccccc1)[C@H](Br)c1ccccc1F |
| InChI | InChI=1S/C14H12BrFO/c15-13(11-8-4-5-9-12(11)16)14(17)10-6-2-1-3-7-10/h1-9,13-14,17H/t13-,14+/m1/s1 |
| InChIKey | CJZIFSVCOGHEBW-KGLIPLIRSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|