C17H32O2Si — CID 11044677
[(1S,2S,4S)-1,5-dimethyl-7-oxabicyclo[2.2.1]hept-5-en-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 11044677) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is [(1S,2S,4S)-1,5-dimethyl-7-oxabicyclo[2.2.1]hept-5-en-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,2S,4S)-1,5-dimethyl-7-oxabicyclo[2.2.1]hept-5-en-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11044677 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | [(1S,2S,4S)-1,5-dimethyl-7-oxabicyclo[2.2.1]hept-5-en-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC1=C[C@]2(C)O[C@H]1C[C@@H]2O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-11(2)20(12(3)4,13(5)6)19-16-9-15-14(7)10-17(16,8)18-15/h10-13,15-16H,9H2,1-8H3/t15-,16-,17-/m0/s1 |
| InChIKey | ANVVCGWQGHGALC-ULQDDVLXSA-N |
| XLogP | 5.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|