C18H36O3Si2 — CID 102014710
tert-butyl-[[(1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl]oxy]-dimethylsilane (PubChem CID 102014710) has the molecular formula C18H36O3Si2 and a molecular weight of 356.66 g/mol. Its IUPAC name is tert-butyl-[[(1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 102014710 |
| Molecular Formula | C18H36O3Si2 |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | tert-butyl-[[(1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[2.2.1]hept-5-en-2-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C18H36O3Si2/c1-17(2,3)22(7,8)20-15-13-11-12-14(19-13)16(15)21-23(9,10)18(4,5)6/h11-16H,1-10H3/t13-,14+,15+,16- |
| InChIKey | NDAGMUXZDZNXSP-SYMSYNOKSA-N |
| XLogP | 5.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|