C17H18F3NO — CID 110447577
3-[4-methoxy-3-(2,3,4-trifluorophenyl)phenyl]butan-1-amine (PubChem CID 110447577) has the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. Its IUPAC name is 3-[4-methoxy-3-(2,3,4-trifluorophenyl)phenyl]butan-1-amine.
| Compound Name | 3-[4-methoxy-3-(2,3,4-trifluorophenyl)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 110447577 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-[4-methoxy-3-(2,3,4-trifluorophenyl)phenyl]butan-1-amine |
| SMILES | COc1ccc(C(C)CCN)cc1-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H18F3NO/c1-10(7-8-21)11-3-6-15(22-2)13(9-11)12-4-5-14(18)17(20)16(12)19/h3-6,9-10H,7-8,21H2,1-2H3 |
| InChIKey | JDQGRRUPKDKVBU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|