C16H9F3N2O2 — CID 110448810
4,5,6-trifluoro-2-(3-methoxyphenyl)-3-oxo-1H-isoindole-1-carbonitrile (PubChem CID 110448810) has the molecular formula C16H9F3N2O2 and a molecular weight of 318.25 g/mol. Its IUPAC name is 4,5,6-trifluoro-2-(3-methoxyphenyl)-3-oxo-1H-isoindole-1-carbonitrile.
| Compound Name | 4,5,6-trifluoro-2-(3-methoxyphenyl)-3-oxo-1H-isoindole-1-carbonitrile |
|---|---|
| PubChem CID | 110448810 |
| Molecular Formula | C16H9F3N2O2 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 4,5,6-trifluoro-2-(3-methoxyphenyl)-3-oxo-1H-isoindole-1-carbonitrile |
| SMILES | COc1cccc(N2C(=O)c3c(cc(F)c(F)c3F)C2C#N)c1 |
| InChI | InChI=1S/C16H9F3N2O2/c1-23-9-4-2-3-8(5-9)21-12(7-20)10-6-11(17)14(18)15(19)13(10)16(21)22/h2-6,12H,1H3 |
| InChIKey | DDXOHCITIVKNRG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|