C14H16ClN5O — CID 11044960
[9-(2-hydroxy-1-phenylethyl)purin-6-yl]-methylazanium chloride (PubChem CID 11044960) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is [9-(2-hydroxy-1-phenylethyl)purin-6-yl]-methylazanium chloride.
| Compound Name | [9-(2-hydroxy-1-phenylethyl)purin-6-yl]-methylazanium chloride |
|---|---|
| PubChem CID | 11044960 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | [9-(2-hydroxy-1-phenylethyl)purin-6-yl]-methylazanium chloride |
| SMILES | C[NH2+]c1ncnc2c1ncn2C(CO)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C14H15N5O.ClH/c1-15-13-12-14(17-8-16-13)19(9-18-12)11(7-20)10-5-3-2-4-6-10;/h2-6,8-9,11,20H,7H2,1H3,(H,15,16,17);1H |
| InChIKey | WXXHYKRFQAAHCD-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |