C19H24ClN3O — CID 110449902
4-[[1-(aminomethyl)-7-chloro-4-methoxy-1,3-dihydroisoindol-2-yl]methyl]-N,N-dimethylaniline (PubChem CID 110449902) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is 4-[[1-(aminomethyl)-7-chloro-4-methoxy-1,3-dihydroisoindol-2-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[1-(aminomethyl)-7-chloro-4-methoxy-1,3-dihydroisoindol-2-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 110449902 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 4-[[1-(aminomethyl)-7-chloro-4-methoxy-1,3-dihydroisoindol-2-yl]methyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(Cl)c2c1CN(Cc1ccc(N(C)C)cc1)C2CN |
| InChI | InChI=1S/C19H24ClN3O/c1-22(2)14-6-4-13(5-7-14)11-23-12-15-18(24-3)9-8-16(20)19(15)17(23)10-21/h4-9,17H,10-12,21H2,1-3H3 |
| InChIKey | ASLIJJAPRXHDEK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|