C13H16N2O5P+ — CID 11045102
(1Z,3Z)-1-dimethoxyphosphoryl-2-hydroxy-4-methoxy-4-phenylbuta-1,3-diene-1-diazonium (PubChem CID 11045102) has the molecular formula C13H16N2O5P+ and a molecular weight of 311.25 g/mol. Its IUPAC name is (1Z,3Z)-1-dimethoxyphosphoryl-2-hydroxy-4-methoxy-4-phenylbuta-1,3-diene-1-diazonium.
| Compound Name | (1Z,3Z)-1-dimethoxyphosphoryl-2-hydroxy-4-methoxy-4-phenylbuta-1,3-diene-1-diazonium |
|---|---|
| PubChem CID | 11045102 |
| Molecular Formula | C13H16N2O5P+ |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (1Z,3Z)-1-dimethoxyphosphoryl-2-hydroxy-4-methoxy-4-phenylbuta-1,3-diene-1-diazonium |
| SMILES | CO/C(=C\C(O)=C(/[N+]#N)P(=O)(OC)OC)c1ccccc1 |
| InChI | InChI=1S/C13H15N2O5P/c1-18-12(10-7-5-4-6-8-10)9-11(16)13(15-14)21(17,19-2)20-3/h4-9H,1-3H3/p+1/b12-9- |
| InChIKey | FCHKORGCFZUWRF-XFXZXTDPSA-O |
| XLogP | 3.74 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|