About (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium
(1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium (PubChem CID 11063834) has the molecular formula C12H13N2O2+
and a molecular weight of 217.25 g/mol. Its IUPAC name is (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium.
Molecular Properties
| Compound Name | (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium |
| PubChem CID | 11063834 |
| Molecular Formula | C12H13N2O2+ |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium |
| SMILES | CO/C(O)=C(/C=C(\C)c1ccccc1)[N+]#N |
| InChI | InChI=1S/C12H12N2O2/c1-9(10-6-4-3-5-7-10)8-11(14-13)12(15)16-2/h3-8H,1-2H3/p+1/b9-8+,12-11- |
| InChIKey | VFWMKISKHBLMDJ-UPDVNHGHSA-O |
| XLogP | 3.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium?
The IUPAC name of (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium (CID 11063834) is (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium.
What is the SMILES notation for (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium?
The canonical SMILES for (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium is CO/C(O)=C(/C=C(\C)c1ccccc1)[N+]#N.
What is the InChIKey of (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium?
The InChIKey is VFWMKISKHBLMDJ-UPDVNHGHSA-O. The full InChI is InChI=1S/C12H12N2O2/c1-9(10-6-4-3-5-7-10)8-11(14-13)12(15)16-2/h3-8H,1-2H3/p+1/b9-8+,12-11-.
What are the key properties of (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium?
(1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium has a molecular weight of 217.25 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium is sourced from PubChem (CID 11063834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).