C12H13N2O2+ — CID 11063834
(1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium (PubChem CID 11063834) has the molecular formula C12H13N2O2+ and a molecular weight of 217.25 g/mol. Its IUPAC name is (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium.
| Compound Name | (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium |
|---|---|
| PubChem CID | 11063834 |
| Molecular Formula | C12H13N2O2+ |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | (1Z,3E)-1-hydroxy-1-methoxy-4-phenylpenta-1,3-diene-2-diazonium |
| SMILES | CO/C(O)=C(/C=C(\C)c1ccccc1)[N+]#N |
| InChI | InChI=1S/C12H12N2O2/c1-9(10-6-4-3-5-7-10)8-11(14-13)12(15)16-2/h3-8H,1-2H3/p+1/b9-8+,12-11- |
| InChIKey | VFWMKISKHBLMDJ-UPDVNHGHSA-O |
| XLogP | 3.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|