C17H12F3N3O — CID 110451369
2-(6-aminoquinolin-2-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 110451369) has the molecular formula C17H12F3N3O and a molecular weight of 331.30 g/mol. Its IUPAC name is 2-(6-aminoquinolin-2-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(6-aminoquinolin-2-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 110451369 |
| Molecular Formula | C17H12F3N3O |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-(6-aminoquinolin-2-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Nc1ccc2nc(CC(=O)Nc3ccc(F)c(F)c3F)ccc2c1 |
| InChI | InChI=1S/C17H12F3N3O/c18-12-4-6-14(17(20)16(12)19)23-15(24)8-11-3-1-9-7-10(21)2-5-13(9)22-11/h1-7H,8,21H2,(H,23,24) |
| InChIKey | NAAUMRQIRHHWKG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|