C19H26N2 — CID 110453205
3-[cyclohexyl(pyrrolidin-1-yl)methyl]-1H-indole (PubChem CID 110453205) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-[cyclohexyl(pyrrolidin-1-yl)methyl]-1H-indole.
| Compound Name | 3-[cyclohexyl(pyrrolidin-1-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 110453205 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 3-[cyclohexyl(pyrrolidin-1-yl)methyl]-1H-indole |
| SMILES | c1ccc2c(C(C3CCCCC3)N3CCCC3)c[nH]c2c1 |
| InChI | InChI=1S/C19H26N2/c1-2-8-15(9-3-1)19(21-12-6-7-13-21)17-14-20-18-11-5-4-10-16(17)18/h4-5,10-11,14-15,19-20H,1-3,6-9,12-13H2 |
| InChIKey | HIRJZIPATXQDHM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |