C21H18N2O2 — CID 110453239
4-[anilino(1H-indol-3-yl)methyl]benzene-1,3-diol (PubChem CID 110453239) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-[anilino(1H-indol-3-yl)methyl]benzene-1,3-diol.
| Compound Name | 4-[anilino(1H-indol-3-yl)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 110453239 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 4-[anilino(1H-indol-3-yl)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(C(Nc2ccccc2)c2c[nH]c3ccccc23)c(O)c1 |
| InChI | InChI=1S/C21H18N2O2/c24-15-10-11-17(20(25)12-15)21(23-14-6-2-1-3-7-14)18-13-22-19-9-5-4-8-16(18)19/h1-13,21-25H |
| InChIKey | MMXRNJWAQUKLLL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|