C21H22N4 — CID 110453329
1-(1-benzylpyrazol-4-yl)-1-(1H-indol-3-yl)-N,N-dimethylmethanamine (PubChem CID 110453329) has the molecular formula C21H22N4 and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-(1-benzylpyrazol-4-yl)-1-(1H-indol-3-yl)-N,N-dimethylmethanamine.
| Compound Name | 1-(1-benzylpyrazol-4-yl)-1-(1H-indol-3-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 110453329 |
| Molecular Formula | C21H22N4 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-(1-benzylpyrazol-4-yl)-1-(1H-indol-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)C(c1cnn(Cc2ccccc2)c1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H22N4/c1-24(2)21(19-13-22-20-11-7-6-10-18(19)20)17-12-23-25(15-17)14-16-8-4-3-5-9-16/h3-13,15,21-22H,14H2,1-2H3 |
| InChIKey | QKJBJBSUADTIFS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |