C28H26N4O — CID 16568385
2-[(1-benzylpyrazol-4-yl)methyl-methylamino]-1-(1H-indol-3-yl)-2-phenylethanone (PubChem CID 16568385) has the molecular formula C28H26N4O and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[(1-benzylpyrazol-4-yl)methyl-methylamino]-1-(1H-indol-3-yl)-2-phenylethanone.
| Compound Name | 2-[(1-benzylpyrazol-4-yl)methyl-methylamino]-1-(1H-indol-3-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 16568385 |
| Molecular Formula | C28H26N4O |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[(1-benzylpyrazol-4-yl)methyl-methylamino]-1-(1H-indol-3-yl)-2-phenylethanone |
| SMILES | CN(Cc1cnn(Cc2ccccc2)c1)C(C(=O)c1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C28H26N4O/c1-31(18-22-16-30-32(20-22)19-21-10-4-2-5-11-21)27(23-12-6-3-7-13-23)28(33)25-17-29-26-15-9-8-14-24(25)26/h2-17,20,27,29H,18-19H2,1H3 |
| InChIKey | UFKCSDJWLBMMLI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |