C27H27N3O2 — CID 9356635
N-(2-ethylphenyl)-2-[[(1S)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]-methylamino]acetamide (PubChem CID 9356635) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[[(1S)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]-methylamino]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[[(1S)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 9356635 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-(2-ethylphenyl)-2-[[(1S)-2-(1H-indol-3-yl)-2-oxo-1-phenylethyl]-methylamino]acetamide |
| SMILES | CCc1ccccc1NC(=O)CN(C)[C@H](C(=O)c1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O2/c1-3-19-11-7-9-15-23(19)29-25(31)18-30(2)26(20-12-5-4-6-13-20)27(32)22-17-28-24-16-10-8-14-21(22)24/h4-17,26,28H,3,18H2,1-2H3,(H,29,31)/t26-/m0/s1 |
| InChIKey | BQNDYWQNPGBTEQ-SANMLTNESA-N |
| XLogP | 5.22 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |