C18H25N3 — CID 110454841
4-benzyl-1-(1,3,5-trimethylpyrazol-4-yl)piperidine (PubChem CID 110454841) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-benzyl-1-(1,3,5-trimethylpyrazol-4-yl)piperidine.
| Compound Name | 4-benzyl-1-(1,3,5-trimethylpyrazol-4-yl)piperidine |
|---|---|
| PubChem CID | 110454841 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 4-benzyl-1-(1,3,5-trimethylpyrazol-4-yl)piperidine |
| SMILES | Cc1nn(C)c(C)c1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H25N3/c1-14-18(15(2)20(3)19-14)21-11-9-17(10-12-21)13-16-7-5-4-6-8-16/h4-8,17H,9-13H2,1-3H3 |
| InChIKey | JDKGXQDSWHVVPZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |