C15H16ClNO — CID 110455038
3-chloro-N-(4-methoxyphenyl)-N,2-dimethylaniline (PubChem CID 110455038) has the molecular formula C15H16ClNO and a molecular weight of 261.75 g/mol. Its IUPAC name is 3-chloro-N-(4-methoxyphenyl)-N,2-dimethylaniline.
| Compound Name | 3-chloro-N-(4-methoxyphenyl)-N,2-dimethylaniline |
|---|---|
| PubChem CID | 110455038 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-chloro-N-(4-methoxyphenyl)-N,2-dimethylaniline |
| SMILES | COc1ccc(N(C)c2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C15H16ClNO/c1-11-14(16)5-4-6-15(11)17(2)12-7-9-13(18-3)10-8-12/h4-10H,1-3H3 |
| InChIKey | JGHWPTOHHZYARF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |