C14H20BrNOSi — CID 11045626
[(2R,3S)-2-(bromomethyl)-5-phenyl-3,4-dihydro-2H-pyrrol-3-yl]oxy-trimethylsilane (PubChem CID 11045626) has the molecular formula C14H20BrNOSi and a molecular weight of 326.31 g/mol. Its IUPAC name is [(2R,3S)-2-(bromomethyl)-5-phenyl-3,4-dihydro-2H-pyrrol-3-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3S)-2-(bromomethyl)-5-phenyl-3,4-dihydro-2H-pyrrol-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11045626 |
| Molecular Formula | C14H20BrNOSi |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | [(2R,3S)-2-(bromomethyl)-5-phenyl-3,4-dihydro-2H-pyrrol-3-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[C@H]1CC(c2ccccc2)=N[C@H]1CBr |
| InChI | InChI=1S/C14H20BrNOSi/c1-18(2,3)17-14-9-12(16-13(14)10-15)11-7-5-4-6-8-11/h4-8,13-14H,9-10H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | PVDCAQRTRGQQFG-KBPBESRZSA-N |
| XLogP | 3.86 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|