C14H16ClN3O3 — CID 110456607
methyl 4-[[[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]amino]methyl]benzoate (PubChem CID 110456607) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is methyl 4-[[[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 110456607 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | methyl 4-[[[5-(3-chloropropyl)-1,3,4-oxadiazol-2-yl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2nnc(CCCCl)o2)cc1 |
| InChI | InChI=1S/C14H16ClN3O3/c1-20-13(19)11-6-4-10(5-7-11)9-16-14-18-17-12(21-14)3-2-8-15/h4-7H,2-3,8-9H2,1H3,(H,16,18) |
| InChIKey | NNOBYOANEAFDFL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|