C14H21NO3 — CID 110457114
2-ethyl-6,7,8-trimethoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 110457114) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-ethyl-6,7,8-trimethoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-ethyl-6,7,8-trimethoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 110457114 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-ethyl-6,7,8-trimethoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | CCN1CCc2cc(OC)c(OC)c(OC)c2C1 |
| InChI | InChI=1S/C14H21NO3/c1-5-15-7-6-10-8-12(16-2)14(18-4)13(17-3)11(10)9-15/h8H,5-7,9H2,1-4H3 |
| InChIKey | MPHOPDCGPGBLHJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |