C27H37NO8 — CID 162659122
1-(2,3,4,5-tetramethoxy-6-methylphenyl)-4-(5,6,7-trimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one (PubChem CID 162659122) has the molecular formula C27H37NO8 and a molecular weight of 503.59 g/mol. Its IUPAC name is 1-(2,3,4,5-tetramethoxy-6-methylphenyl)-4-(5,6,7-trimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one.
| Compound Name | 1-(2,3,4,5-tetramethoxy-6-methylphenyl)-4-(5,6,7-trimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one |
|---|---|
| PubChem CID | 162659122 |
| Molecular Formula | C27H37NO8 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 1-(2,3,4,5-tetramethoxy-6-methylphenyl)-4-(5,6,7-trimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butan-1-one |
| SMILES | COc1cc2c(c(OC)c1OC)CCN(CCCC(=O)c1c(C)c(OC)c(OC)c(OC)c1OC)C2 |
| InChI | InChI=1S/C27H37NO8/c1-16-21(25(34-6)27(36-8)26(35-7)22(16)31-3)19(29)10-9-12-28-13-11-18-17(15-28)14-20(30-2)24(33-5)23(18)32-4/h14H,9-13,15H2,1-8H3 |
| InChIKey | DAYRIJHKKBSVNA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |