C13H17NO4 — CID 11086211
5,6,7-trimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 11086211) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 5,6,7-trimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | 5,6,7-trimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 11086211 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 5,6,7-trimethoxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | COc1cc2c(c(OC)c1OC)CCN(C=O)C2 |
| InChI | InChI=1S/C13H17NO4/c1-16-11-6-9-7-14(8-15)5-4-10(9)12(17-2)13(11)18-3/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | UCGVIYHRASEYIY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|