C22H25NO6 — CID 162352401
(1Z)-6,7-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydroisoquinoline-2-carbaldehyde (PubChem CID 162352401) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is (1Z)-6,7-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydroisoquinoline-2-carbaldehyde.
| Compound Name | (1Z)-6,7-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydroisoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 162352401 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (1Z)-6,7-dimethoxy-1-[(3,4,5-trimethoxyphenyl)methylidene]-3,4-dihydroisoquinoline-2-carbaldehyde |
| SMILES | COc1cc2c(cc1OC)/C(=C/c1cc(OC)c(OC)c(OC)c1)N(C=O)CC2 |
| InChI | InChI=1S/C22H25NO6/c1-25-18-11-15-6-7-23(13-24)17(16(15)12-19(18)26-2)8-14-9-20(27-3)22(29-5)21(10-14)28-4/h8-13H,6-7H2,1-5H3/b17-8- |
| InChIKey | OLSVBLLBYSZIDR-IUXPMGMMSA-N |
| XLogP | 3.24 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|