C17H19NO5 — CID 88881323
prop-2-enyl (1Z)-6,7-dimethoxy-1-(2-oxoethylidene)-3,4-dihydroisoquinoline-2-carboxylate (PubChem CID 88881323) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is prop-2-enyl (1Z)-6,7-dimethoxy-1-(2-oxoethylidene)-3,4-dihydroisoquinoline-2-carboxylate.
| Compound Name | prop-2-enyl (1Z)-6,7-dimethoxy-1-(2-oxoethylidene)-3,4-dihydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 88881323 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | prop-2-enyl (1Z)-6,7-dimethoxy-1-(2-oxoethylidene)-3,4-dihydroisoquinoline-2-carboxylate |
| SMILES | C=CCOC(=O)N1CCc2cc(OC)c(OC)cc2/C1=C/C=O |
| InChI | InChI=1S/C17H19NO5/c1-4-9-23-17(20)18-7-5-12-10-15(21-2)16(22-3)11-13(12)14(18)6-8-19/h4,6,8,10-11H,1,5,7,9H2,2-3H3/b14-6- |
| InChIKey | CUQXZKFZXMZVOE-NSIKDUERSA-N |
| XLogP | 2.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|