C24H27NO6 — CID 7094083
(4R)-9,10-dimethoxy-4-(3,4,5-trimethoxyphenyl)-3,4,6,7-tetrahydrobenzo[a]quinolizin-2-one (PubChem CID 7094083) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is (4R)-9,10-dimethoxy-4-(3,4,5-trimethoxyphenyl)-3,4,6,7-tetrahydrobenzo[a]quinolizin-2-one.
| Compound Name | (4R)-9,10-dimethoxy-4-(3,4,5-trimethoxyphenyl)-3,4,6,7-tetrahydrobenzo[a]quinolizin-2-one |
|---|---|
| PubChem CID | 7094083 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (4R)-9,10-dimethoxy-4-(3,4,5-trimethoxyphenyl)-3,4,6,7-tetrahydrobenzo[a]quinolizin-2-one |
| SMILES | COc1cc2c(cc1OC)C1=CC(=O)C[C@H](c3cc(OC)c(OC)c(OC)c3)N1CC2 |
| InChI | InChI=1S/C24H27NO6/c1-27-20-8-14-6-7-25-18(11-16(26)12-19(25)17(14)13-21(20)28-2)15-9-22(29-3)24(31-5)23(10-15)30-4/h8-10,12-13,18H,6-7,11H2,1-5H3/t18-/m1/s1 |
| InChIKey | XTWOQEJDTAFRFV-GOSISDBHSA-N |
| XLogP | 3.64 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |