C14H19NO2 — CID 139399459
7-ethoxy-6-ethyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 139399459) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 7-ethoxy-6-ethyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | 7-ethoxy-6-ethyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 139399459 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 7-ethoxy-6-ethyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | CCOc1cc2c(cc1CC)CCN(C=O)C2 |
| InChI | InChI=1S/C14H19NO2/c1-3-11-7-12-5-6-15(10-16)9-13(12)8-14(11)17-4-2/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | BMWHYVAXBVGNFV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|