C19H21NO3S — CID 11405173
7,8-dimethoxy-5-phenylsulfanyl-1,3,4,5-tetrahydro-2-benzazepine-2-carbaldehyde (PubChem CID 11405173) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 7,8-dimethoxy-5-phenylsulfanyl-1,3,4,5-tetrahydro-2-benzazepine-2-carbaldehyde.
| Compound Name | 7,8-dimethoxy-5-phenylsulfanyl-1,3,4,5-tetrahydro-2-benzazepine-2-carbaldehyde |
|---|---|
| PubChem CID | 11405173 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 7,8-dimethoxy-5-phenylsulfanyl-1,3,4,5-tetrahydro-2-benzazepine-2-carbaldehyde |
| SMILES | COc1cc2c(cc1OC)C(Sc1ccccc1)CCN(C=O)C2 |
| InChI | InChI=1S/C19H21NO3S/c1-22-17-10-14-12-20(13-21)9-8-19(16(14)11-18(17)23-2)24-15-6-4-3-5-7-15/h3-7,10-11,13,19H,8-9,12H2,1-2H3 |
| InChIKey | NNQJTBSSXSVELY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|