C24H27NO5S — CID 100930772
ethyl (1R,2R,11bR)-9,10-dimethoxy-6-oxo-1-phenylsulfanyl-1,2,3,4,7,11b-hexahydrobenzo[a]quinolizine-2-carboxylate (PubChem CID 100930772) has the molecular formula C24H27NO5S and a molecular weight of 441.55 g/mol. Its IUPAC name is ethyl (1R,2R,11bR)-9,10-dimethoxy-6-oxo-1-phenylsulfanyl-1,2,3,4,7,11b-hexahydrobenzo[a]quinolizine-2-carboxylate.
| Compound Name | ethyl (1R,2R,11bR)-9,10-dimethoxy-6-oxo-1-phenylsulfanyl-1,2,3,4,7,11b-hexahydrobenzo[a]quinolizine-2-carboxylate |
|---|---|
| PubChem CID | 100930772 |
| Molecular Formula | C24H27NO5S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | ethyl (1R,2R,11bR)-9,10-dimethoxy-6-oxo-1-phenylsulfanyl-1,2,3,4,7,11b-hexahydrobenzo[a]quinolizine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCN2C(=O)Cc3cc(OC)c(OC)cc3[C@@H]2[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C24H27NO5S/c1-4-30-24(27)17-10-11-25-21(26)13-15-12-19(28-2)20(29-3)14-18(15)22(25)23(17)31-16-8-6-5-7-9-16/h5-9,12,14,17,22-23H,4,10-11,13H2,1-3H3/t17-,22+,23+/m0/s1 |
| InChIKey | CMPGNPDPEHNNCO-JJEOQYAHSA-N |
| XLogP | 3.87 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |