C21H26O2S — CID 134982595
5,6-dimethoxy-2,2,3,3-tetramethyl-1-phenylsulfanyl-1H-indene (PubChem CID 134982595) has the molecular formula C21H26O2S and a molecular weight of 342.50 g/mol. Its IUPAC name is 5,6-dimethoxy-2,2,3,3-tetramethyl-1-phenylsulfanyl-1H-indene.
| Compound Name | 5,6-dimethoxy-2,2,3,3-tetramethyl-1-phenylsulfanyl-1H-indene |
|---|---|
| PubChem CID | 134982595 |
| Molecular Formula | C21H26O2S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 5,6-dimethoxy-2,2,3,3-tetramethyl-1-phenylsulfanyl-1H-indene |
| SMILES | COc1cc2c(cc1OC)C(C)(C)C(C)(C)C2Sc1ccccc1 |
| InChI | InChI=1S/C21H26O2S/c1-20(2)16-13-18(23-6)17(22-5)12-15(16)19(21(20,3)4)24-14-10-8-7-9-11-14/h7-13,19H,1-6H3 |
| InChIKey | VGFANYVPENAEEQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |