C25H30O2S — CID 10000739
6-methoxy-1,1,4a,7-tetramethyl-2-phenylsulfanyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one (PubChem CID 10000739) has the molecular formula C25H30O2S and a molecular weight of 394.58 g/mol. Its IUPAC name is 6-methoxy-1,1,4a,7-tetramethyl-2-phenylsulfanyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one.
| Compound Name | 6-methoxy-1,1,4a,7-tetramethyl-2-phenylsulfanyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
|---|---|
| PubChem CID | 10000739 |
| Molecular Formula | C25H30O2S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 6-methoxy-1,1,4a,7-tetramethyl-2-phenylsulfanyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
| SMILES | COc1cc2c(cc1C)C(=O)CC1C2(C)CCC(Sc2ccccc2)C1(C)C |
| InChI | InChI=1S/C25H30O2S/c1-16-13-18-19(14-21(16)27-5)25(4)12-11-23(28-17-9-7-6-8-10-17)24(2,3)22(25)15-20(18)26/h6-10,13-14,22-23H,11-12,15H2,1-5H3 |
| InChIKey | NRUUQXZCVWKZOB-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |