C26H30ClNO2S — CID 10837497
(2S,4aS,9S,10aR)-2-(4-chlorophenyl)sulfanyl-6,7-dimethoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-9-carbonitrile (PubChem CID 10837497) has the molecular formula C26H30ClNO2S and a molecular weight of 456.05 g/mol. Its IUPAC name is (2S,4aS,9S,10aR)-2-(4-chlorophenyl)sulfanyl-6,7-dimethoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-9-carbonitrile.
| Compound Name | (2S,4aS,9S,10aR)-2-(4-chlorophenyl)sulfanyl-6,7-dimethoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-9-carbonitrile |
|---|---|
| PubChem CID | 10837497 |
| Molecular Formula | C26H30ClNO2S |
| Molecular Weight | 456.05 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | (2S,4aS,9S,10aR)-2-(4-chlorophenyl)sulfanyl-6,7-dimethoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene-9-carbonitrile |
| SMILES | COc1cc2c(cc1OC)[C@@]1(C)CC[C@H](Sc3ccc(Cl)cc3)C(C)(C)[C@@H]1C[C@@H]2C#N |
| InChI | InChI=1S/C26H30ClNO2S/c1-25(2)23-12-16(15-28)19-13-21(29-4)22(30-5)14-20(19)26(23,3)11-10-24(25)31-18-8-6-17(27)7-9-18/h6-9,13-14,16,23-24H,10-12H2,1-5H3/t16-,23+,24+,26-/m1/s1 |
| InChIKey | PXTCPBYZCRLPMZ-PYTIWUIXSA-N |
| XLogP | 7.22 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.05 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |