C25H22BrClN2O3 — CID 4525048
4-(2-bromo-4,5-dimethoxyphenyl)-7-(4-chlorophenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carbonitrile (PubChem CID 4525048) has the molecular formula C25H22BrClN2O3 and a molecular weight of 513.82 g/mol. Its IUPAC name is 4-(2-bromo-4,5-dimethoxyphenyl)-7-(4-chlorophenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carbonitrile.
| Compound Name | 4-(2-bromo-4,5-dimethoxyphenyl)-7-(4-chlorophenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 4525048 |
| Molecular Formula | C25H22BrClN2O3 |
| Molecular Weight | 513.82 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 4-(2-bromo-4,5-dimethoxyphenyl)-7-(4-chlorophenyl)-2-methylidene-5-oxo-1,3,4,6,7,8-hexahydroquinoline-3-carbonitrile |
| SMILES | C=C1NC2=C(C(=O)CC(c3ccc(Cl)cc3)C2)C(c2cc(OC)c(OC)cc2Br)C1C#N |
| InChI | InChI=1S/C25H22BrClN2O3/c1-13-18(12-28)24(17-10-22(31-2)23(32-3)11-19(17)26)25-20(29-13)8-15(9-21(25)30)14-4-6-16(27)7-5-14/h4-7,10-11,15,18,24,29H,1,8-9H2,2-3H3 |
| InChIKey | BRILCQWVMFMAJZ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.82 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |