C24H24O2 — CID 101346983
(1R,3S)-5,6-dimethoxy-3-methyl-1,3-diphenyl-1,2-dihydroindene (PubChem CID 101346983) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is (1R,3S)-5,6-dimethoxy-3-methyl-1,3-diphenyl-1,2-dihydroindene.
| Compound Name | (1R,3S)-5,6-dimethoxy-3-methyl-1,3-diphenyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 101346983 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (1R,3S)-5,6-dimethoxy-3-methyl-1,3-diphenyl-1,2-dihydroindene |
| SMILES | COc1cc2c(cc1OC)[C@](C)(c1ccccc1)C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C24H24O2/c1-24(18-12-8-5-9-13-18)16-20(17-10-6-4-7-11-17)19-14-22(25-2)23(26-3)15-21(19)24/h4-15,20H,16H2,1-3H3/t20-,24+/m1/s1 |
| InChIKey | GFWZNEHKFCWZCT-YKSBVNFPSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |