C21H28N2O2 — CID 142644287
3,3-diethyl-7,8-dimethoxy-5-phenyl-1,2,4,5-tetrahydro-1,4-benzodiazepine (PubChem CID 142644287) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 3,3-diethyl-7,8-dimethoxy-5-phenyl-1,2,4,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 3,3-diethyl-7,8-dimethoxy-5-phenyl-1,2,4,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 142644287 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 3,3-diethyl-7,8-dimethoxy-5-phenyl-1,2,4,5-tetrahydro-1,4-benzodiazepine |
| SMILES | CCC1(CC)CNc2cc(OC)c(OC)cc2C(c2ccccc2)N1 |
| InChI | InChI=1S/C21H28N2O2/c1-5-21(6-2)14-22-17-13-19(25-4)18(24-3)12-16(17)20(23-21)15-10-8-7-9-11-15/h7-13,20,22-23H,5-6,14H2,1-4H3 |
| InChIKey | HDAUVMOJZVKXGQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|