C20H13ClN2O2 — CID 110457964
(3E)-1-(3-chlorophenyl)-3-(quinolin-3-ylmethylidene)pyrrolidine-2,5-dione (PubChem CID 110457964) has the molecular formula C20H13ClN2O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is (3E)-1-(3-chlorophenyl)-3-(quinolin-3-ylmethylidene)pyrrolidine-2,5-dione.
| Compound Name | (3E)-1-(3-chlorophenyl)-3-(quinolin-3-ylmethylidene)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 110457964 |
| Molecular Formula | C20H13ClN2O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (3E)-1-(3-chlorophenyl)-3-(quinolin-3-ylmethylidene)pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnc3ccccc3c2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H13ClN2O2/c21-16-5-3-6-17(11-16)23-19(24)10-15(20(23)25)9-13-8-14-4-1-2-7-18(14)22-12-13/h1-9,11-12H,10H2/b15-9+ |
| InChIKey | COHFMGUKLBMVOO-OQLLNIDSSA-N |
| XLogP | 4.24 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|